About 3-[5-(chloromethyl)-1,3-thiazol-2-yl]pyridin-2-amine;hydrochloride
3-[5-(chloromethyl)-1,3-thiazol-2-yl]pyridin-2-amine;hydrochloride (PubChem CID 22019060) has the molecular formula C9H9Cl2N3S
and a molecular weight of 262.16 g/mol. Its IUPAC name is 3-[5-(chloromethyl)-1,3-thiazol-2-yl]pyridin-2-amine;hydrochloride.
Molecular Properties
| Compound Name | 3-[5-(chloromethyl)-1,3-thiazol-2-yl]pyridin-2-amine;hydrochloride |
| PubChem CID | 22019060 |
| Molecular Formula | C9H9Cl2N3S |
| Molecular Weight | 262.16 g/mol |
| Exact Mass | 260.99 |
| IUPAC Name | 3-[5-(chloromethyl)-1,3-thiazol-2-yl]pyridin-2-amine;hydrochloride |
| SMILES | Cl.Nc1ncccc1-c1ncc(CCl)s1 |
| InChI | InChI=1S/C9H8ClN3S.ClH/c10-4-6-5-13-9(14-6)7-2-1-3-12-8(7)11;/h1-3,5H,4H2,(H2,11,12);1H |
| InChIKey | ATQIGZMQUIXPLX-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.16 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 3-[5-(chloromethyl)-1,3-thiazol-2-yl]pyridin-2-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[5-(chloromethyl)-1,3-thiazol-2-yl]pyridin-2-amine;hydrochloride?
The IUPAC name of 3-[5-(chloromethyl)-1,3-thiazol-2-yl]pyridin-2-amine;hydrochloride (CID 22019060) is 3-[5-(chloromethyl)-1,3-thiazol-2-yl]pyridin-2-amine;hydrochloride.
What is the SMILES notation for 3-[5-(chloromethyl)-1,3-thiazol-2-yl]pyridin-2-amine;hydrochloride?
The canonical SMILES for 3-[5-(chloromethyl)-1,3-thiazol-2-yl]pyridin-2-amine;hydrochloride is Cl.Nc1ncccc1-c1ncc(CCl)s1.
What is the InChIKey of 3-[5-(chloromethyl)-1,3-thiazol-2-yl]pyridin-2-amine;hydrochloride?
The InChIKey is ATQIGZMQUIXPLX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8ClN3S.ClH/c10-4-6-5-13-9(14-6)7-2-1-3-12-8(7)11;/h1-3,5H,4H2,(H2,11,12);1H.
What are the key properties of 3-[5-(chloromethyl)-1,3-thiazol-2-yl]pyridin-2-amine;hydrochloride?
3-[5-(chloromethyl)-1,3-thiazol-2-yl]pyridin-2-amine;hydrochloride has a molecular weight of 262.16 g/mol, XLogP of 2.95, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[5-(chloromethyl)-1,3-thiazol-2-yl]pyridin-2-amine;hydrochloride is sourced from PubChem (CID 22019060), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).