About 5-nitro-1,2-thiazole-3-carboxylic acid
5-nitro-1,2-thiazole-3-carboxylic acid (PubChem CID 22019223) has the molecular formula C4H2N2O4S
and a molecular weight of 174.14 g/mol. Its IUPAC name is 5-nitro-1,2-thiazole-3-carboxylic acid.
Molecular Properties
| Compound Name | 5-nitro-1,2-thiazole-3-carboxylic acid |
| PubChem CID | 22019223 |
| Molecular Formula | C4H2N2O4S |
| Molecular Weight | 174.14 g/mol |
| Exact Mass | 173.97 |
| IUPAC Name | 5-nitro-1,2-thiazole-3-carboxylic acid |
| SMILES | O=C(O)c1cc([N+](=O)[O-])sn1 |
| InChI | InChI=1S/C4H2N2O4S/c7-4(8)2-1-3(6(9)10)11-5-2/h1H,(H,7,8) |
| InChIKey | VYNSNKZEWKFVJN-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 93.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.14 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-nitro-1,2-thiazole-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-nitro-1,2-thiazole-3-carboxylic acid?
The IUPAC name of 5-nitro-1,2-thiazole-3-carboxylic acid (CID 22019223) is 5-nitro-1,2-thiazole-3-carboxylic acid.
What is the SMILES notation for 5-nitro-1,2-thiazole-3-carboxylic acid?
The canonical SMILES for 5-nitro-1,2-thiazole-3-carboxylic acid is O=C(O)c1cc([N+](=O)[O-])sn1.
What is the InChIKey of 5-nitro-1,2-thiazole-3-carboxylic acid?
The InChIKey is VYNSNKZEWKFVJN-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H2N2O4S/c7-4(8)2-1-3(6(9)10)11-5-2/h1H,(H,7,8).
What are the key properties of 5-nitro-1,2-thiazole-3-carboxylic acid?
5-nitro-1,2-thiazole-3-carboxylic acid has a molecular weight of 174.14 g/mol, XLogP of 0.75, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-nitro-1,2-thiazole-3-carboxylic acid is sourced from PubChem (CID 22019223), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).