C52H60N6O3 — CID 22019289
4-[5,5-bis(1H-indol-3-yl)pentyl]-2-[[4-[5,5-bis(1H-indol-3-yl)pentyl]morpholin-2-yl]methoxymethyl]morpholine (PubChem CID 22019289) has the molecular formula C52H60N6O3 and a molecular weight of 817.09 g/mol. Its IUPAC name is 4-[5,5-bis(1H-indol-3-yl)pentyl]-2-[[4-[5,5-bis(1H-indol-3-yl)pentyl]morpholin-2-yl]methoxymethyl]morpholine.
| Compound Name | 4-[5,5-bis(1H-indol-3-yl)pentyl]-2-[[4-[5,5-bis(1H-indol-3-yl)pentyl]morpholin-2-yl]methoxymethyl]morpholine |
|---|---|
| PubChem CID | 22019289 |
| Molecular Formula | C52H60N6O3 |
| Molecular Weight | 817.09 g/mol |
| Exact Mass | 816.47 |
| IUPAC Name | 4-[5,5-bis(1H-indol-3-yl)pentyl]-2-[[4-[5,5-bis(1H-indol-3-yl)pentyl]morpholin-2-yl]methoxymethyl]morpholine |
| SMILES | c1ccc2c(C(CCCCN3CCOC(COCC4CN(CCCCC(c5c[nH]c6ccccc56)c5c[nH]c6ccccc56)CCO4)C3)c3c[nH]c4ccccc34)c[nH]c2c1 |
| InChI | InChI=1S/C52H60N6O3/c1-5-19-49-41(15-1)45(29-53-49)39(46-30-54-50-20-6-2-16-42(46)50)13-9-11-23-57-25-27-60-37(33-57)35-59-36-38-34-58(26-28-61-38)24-12-10-14-40(47-31-55-51-21-7-3-17-43(47)51)48-32-56-52-22-8-4-18-44(48)52/h1-8,15-22,29-32,37-40,53-56H,9-14,23-28,33-36H2 |
| InChIKey | QXRHGASJHJZFTR-UHFFFAOYSA-N |
| XLogP | 10.33 |
| TPSA | 97.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 817.09 |
| LogP ≤ 5 | 10.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|