About 3,3-bis(1H-indol-3-yl)propane-1,2-diol
3,3-bis(1H-indol-3-yl)propane-1,2-diol (PubChem CID 22019312) has the molecular formula C19H18N2O2
and a molecular weight of 306.37 g/mol. Its IUPAC name is 3,3-bis(1H-indol-3-yl)propane-1,2-diol.
Molecular Properties
| Compound Name | 3,3-bis(1H-indol-3-yl)propane-1,2-diol |
| PubChem CID | 22019312 |
| Molecular Formula | C19H18N2O2 |
| Molecular Weight | 306.37 g/mol |
| Exact Mass | 306.14 |
| IUPAC Name | 3,3-bis(1H-indol-3-yl)propane-1,2-diol |
| SMILES | OCC(O)C(c1c[nH]c2ccccc12)c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C19H18N2O2/c22-11-18(23)19(14-9-20-16-7-3-1-5-12(14)16)15-10-21-17-8-4-2-6-13(15)17/h1-10,18-23H,11H2 |
| InChIKey | OGXNFSOEIVPPSG-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 72.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.37 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3,3-bis(1H-indol-3-yl)propane-1,2-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,3-bis(1H-indol-3-yl)propane-1,2-diol?
The IUPAC name of 3,3-bis(1H-indol-3-yl)propane-1,2-diol (CID 22019312) is 3,3-bis(1H-indol-3-yl)propane-1,2-diol.
What is the SMILES notation for 3,3-bis(1H-indol-3-yl)propane-1,2-diol?
The canonical SMILES for 3,3-bis(1H-indol-3-yl)propane-1,2-diol is OCC(O)C(c1c[nH]c2ccccc12)c1c[nH]c2ccccc12.
What is the InChIKey of 3,3-bis(1H-indol-3-yl)propane-1,2-diol?
The InChIKey is OGXNFSOEIVPPSG-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H18N2O2/c22-11-18(23)19(14-9-20-16-7-3-1-5-12(14)16)15-10-21-17-8-4-2-6-13(15)17/h1-10,18-23H,11H2.
What are the key properties of 3,3-bis(1H-indol-3-yl)propane-1,2-diol?
3,3-bis(1H-indol-3-yl)propane-1,2-diol has a molecular weight of 306.37 g/mol, XLogP of 3.13, 4 rotatable bonds, 4 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,3-bis(1H-indol-3-yl)propane-1,2-diol is sourced from PubChem (CID 22019312), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).