About ethyl 2-(3,5-ditert-butyl-4-oxocyclohexa-2,5-dien-1-ylidene)acetate
ethyl 2-(3,5-ditert-butyl-4-oxocyclohexa-2,5-dien-1-ylidene)acetate (PubChem CID 22019852) has the molecular formula C18H26O3
and a molecular weight of 290.40 g/mol. Its IUPAC name is ethyl 2-(3,5-ditert-butyl-4-oxocyclohexa-2,5-dien-1-ylidene)acetate.
Molecular Properties
| Compound Name | ethyl 2-(3,5-ditert-butyl-4-oxocyclohexa-2,5-dien-1-ylidene)acetate |
| PubChem CID | 22019852 |
| Molecular Formula | C18H26O3 |
| Molecular Weight | 290.40 g/mol |
| Exact Mass | 290.19 |
| IUPAC Name | ethyl 2-(3,5-ditert-butyl-4-oxocyclohexa-2,5-dien-1-ylidene)acetate |
| SMILES | CCOC(=O)C=C1C=C(C(C)(C)C)C(=O)C(C(C)(C)C)=C1 |
| InChI | InChI=1S/C18H26O3/c1-8-21-15(19)11-12-9-13(17(2,3)4)16(20)14(10-12)18(5,6)7/h9-11H,8H2,1-7H3 |
| InChIKey | LKNUTVJHUYBQPK-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.40 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze ethyl 2-(3,5-ditert-butyl-4-oxocyclohexa-2,5-dien-1-ylidene)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-(3,5-ditert-butyl-4-oxocyclohexa-2,5-dien-1-ylidene)acetate?
The IUPAC name of ethyl 2-(3,5-ditert-butyl-4-oxocyclohexa-2,5-dien-1-ylidene)acetate (CID 22019852) is ethyl 2-(3,5-ditert-butyl-4-oxocyclohexa-2,5-dien-1-ylidene)acetate.
What is the SMILES notation for ethyl 2-(3,5-ditert-butyl-4-oxocyclohexa-2,5-dien-1-ylidene)acetate?
The canonical SMILES for ethyl 2-(3,5-ditert-butyl-4-oxocyclohexa-2,5-dien-1-ylidene)acetate is CCOC(=O)C=C1C=C(C(C)(C)C)C(=O)C(C(C)(C)C)=C1.
What is the InChIKey of ethyl 2-(3,5-ditert-butyl-4-oxocyclohexa-2,5-dien-1-ylidene)acetate?
The InChIKey is LKNUTVJHUYBQPK-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H26O3/c1-8-21-15(19)11-12-9-13(17(2,3)4)16(20)14(10-12)18(5,6)7/h9-11H,8H2,1-7H3.
What are the key properties of ethyl 2-(3,5-ditert-butyl-4-oxocyclohexa-2,5-dien-1-ylidene)acetate?
ethyl 2-(3,5-ditert-butyl-4-oxocyclohexa-2,5-dien-1-ylidene)acetate has a molecular weight of 290.40 g/mol, XLogP of 4.00, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-(3,5-ditert-butyl-4-oxocyclohexa-2,5-dien-1-ylidene)acetate is sourced from PubChem (CID 22019852), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).