C20H31NO2 — CID 22019858
2-(3,5-ditert-butyl-4-oxocyclohexa-2,5-dien-1-ylidene)-N,N-diethylacetamide (PubChem CID 22019858) has the molecular formula C20H31NO2 and a molecular weight of 317.47 g/mol. Its IUPAC name is 2-(3,5-ditert-butyl-4-oxocyclohexa-2,5-dien-1-ylidene)-N,N-diethylacetamide.
| Compound Name | 2-(3,5-ditert-butyl-4-oxocyclohexa-2,5-dien-1-ylidene)-N,N-diethylacetamide |
|---|---|
| PubChem CID | 22019858 |
| Molecular Formula | C20H31NO2 |
| Molecular Weight | 317.47 g/mol |
| Exact Mass | 317.24 |
| IUPAC Name | 2-(3,5-ditert-butyl-4-oxocyclohexa-2,5-dien-1-ylidene)-N,N-diethylacetamide |
| SMILES | CCN(CC)C(=O)C=C1C=C(C(C)(C)C)C(=O)C(C(C)(C)C)=C1 |
| InChI | InChI=1S/C20H31NO2/c1-9-21(10-2)17(22)13-14-11-15(19(3,4)5)18(23)16(12-14)20(6,7)8/h11-13H,9-10H2,1-8H3 |
| InChIKey | XLUYBJZPUGOPSS-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.47 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|