About 1,2-benzoxazin-4-one
1,2-benzoxazin-4-one (PubChem CID 22019877) has the molecular formula C8H5NO2
and a molecular weight of 147.13 g/mol. Its IUPAC name is 1,2-benzoxazin-4-one.
Molecular Properties
| Compound Name | 1,2-benzoxazin-4-one |
| PubChem CID | 22019877 |
| Molecular Formula | C8H5NO2 |
| Molecular Weight | 147.13 g/mol |
| Exact Mass | 147.03 |
| IUPAC Name | 1,2-benzoxazin-4-one |
| SMILES | O=c1cnoc2ccccc12 |
| InChI | InChI=1S/C8H5NO2/c10-7-5-9-11-8-4-2-1-3-6(7)8/h1-5H |
| InChIKey | HTWMTDKMOSSPMU-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 43.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 147.13 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1,2-benzoxazin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-benzoxazin-4-one?
The IUPAC name of 1,2-benzoxazin-4-one (CID 22019877) is 1,2-benzoxazin-4-one.
What is the SMILES notation for 1,2-benzoxazin-4-one?
The canonical SMILES for 1,2-benzoxazin-4-one is O=c1cnoc2ccccc12.
What is the InChIKey of 1,2-benzoxazin-4-one?
The InChIKey is HTWMTDKMOSSPMU-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H5NO2/c10-7-5-9-11-8-4-2-1-3-6(7)8/h1-5H.
What are the key properties of 1,2-benzoxazin-4-one?
1,2-benzoxazin-4-one has a molecular weight of 147.13 g/mol, XLogP of 1.19, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-benzoxazin-4-one is sourced from PubChem (CID 22019877), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).