About 1-bicyclo[2.2.1]hept-2-enyl 2-methyloctanoate
1-bicyclo[2.2.1]hept-2-enyl 2-methyloctanoate (PubChem CID 22020020) has the molecular formula C16H26O2
and a molecular weight of 250.38 g/mol. Its IUPAC name is 1-bicyclo[2.2.1]hept-2-enyl 2-methyloctanoate.
Molecular Properties
| Compound Name | 1-bicyclo[2.2.1]hept-2-enyl 2-methyloctanoate |
| PubChem CID | 22020020 |
| Molecular Formula | C16H26O2 |
| Molecular Weight | 250.38 g/mol |
| Exact Mass | 250.19 |
| IUPAC Name | 1-bicyclo[2.2.1]hept-2-enyl 2-methyloctanoate |
| SMILES | CCCCCCC(C)C(=O)OC12C=CC(CC1)C2 |
| InChI | InChI=1S/C16H26O2/c1-3-4-5-6-7-13(2)15(17)18-16-10-8-14(12-16)9-11-16/h8,10,13-14H,3-7,9,11-12H2,1-2H3 |
| InChIKey | ASWUWXYCFUEMPP-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.38 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-bicyclo[2.2.1]hept-2-enyl 2-methyloctanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-bicyclo[2.2.1]hept-2-enyl 2-methyloctanoate?
The IUPAC name of 1-bicyclo[2.2.1]hept-2-enyl 2-methyloctanoate (CID 22020020) is 1-bicyclo[2.2.1]hept-2-enyl 2-methyloctanoate.
What is the SMILES notation for 1-bicyclo[2.2.1]hept-2-enyl 2-methyloctanoate?
The canonical SMILES for 1-bicyclo[2.2.1]hept-2-enyl 2-methyloctanoate is CCCCCCC(C)C(=O)OC12C=CC(CC1)C2.
What is the InChIKey of 1-bicyclo[2.2.1]hept-2-enyl 2-methyloctanoate?
The InChIKey is ASWUWXYCFUEMPP-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H26O2/c1-3-4-5-6-7-13(2)15(17)18-16-10-8-14(12-16)9-11-16/h8,10,13-14H,3-7,9,11-12H2,1-2H3.
What are the key properties of 1-bicyclo[2.2.1]hept-2-enyl 2-methyloctanoate?
1-bicyclo[2.2.1]hept-2-enyl 2-methyloctanoate has a molecular weight of 250.38 g/mol, XLogP of 4.24, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-bicyclo[2.2.1]hept-2-enyl 2-methyloctanoate is sourced from PubChem (CID 22020020), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).