C12H24O4Si4 — CID 22020068
2,2,4,4-tetrakis(ethenyl)-6,6,8,8-tetramethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocane (PubChem CID 22020068) has the molecular formula C12H24O4Si4 and a molecular weight of 344.66 g/mol. Its IUPAC name is 2,2,4,4-tetrakis(ethenyl)-6,6,8,8-tetramethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocane.
| Compound Name | 2,2,4,4-tetrakis(ethenyl)-6,6,8,8-tetramethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocane |
|---|---|
| PubChem CID | 22020068 |
| Molecular Formula | C12H24O4Si4 |
| Molecular Weight | 344.66 g/mol |
| Exact Mass | 344.08 |
| IUPAC Name | 2,2,4,4-tetrakis(ethenyl)-6,6,8,8-tetramethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocane |
| SMILES | C=C[Si]1(C=C)O[Si](C)(C)O[Si](C)(C)O[Si](C=C)(C=C)O1 |
| InChI | InChI=1S/C12H24O4Si4/c1-9-19(10-2)14-17(5,6)13-18(7,8)15-20(11-3,12-4)16-19/h9-12H,1-4H2,5-8H3 |
| InChIKey | YIZXKRBCNIVFMD-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.66 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|