About 9H-fluoren-9-ylmethyl 3-methylbutanoate
9H-fluoren-9-ylmethyl 3-methylbutanoate (PubChem CID 22020159) has the molecular formula C19H20O2
and a molecular weight of 280.37 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl 3-methylbutanoate.
Molecular Properties
| Compound Name | 9H-fluoren-9-ylmethyl 3-methylbutanoate |
| PubChem CID | 22020159 |
| Molecular Formula | C19H20O2 |
| Molecular Weight | 280.37 g/mol |
| Exact Mass | 280.15 |
| IUPAC Name | 9H-fluoren-9-ylmethyl 3-methylbutanoate |
| SMILES | CC(C)CC(=O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C19H20O2/c1-13(2)11-19(20)21-12-18-16-9-5-3-7-14(16)15-8-4-6-10-17(15)18/h3-10,13,18H,11-12H2,1-2H3 |
| InChIKey | DPHKUWFYURIUPZ-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.37 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 9H-fluoren-9-ylmethyl 3-methylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9H-fluoren-9-ylmethyl 3-methylbutanoate?
The IUPAC name of 9H-fluoren-9-ylmethyl 3-methylbutanoate (CID 22020159) is 9H-fluoren-9-ylmethyl 3-methylbutanoate.
What is the SMILES notation for 9H-fluoren-9-ylmethyl 3-methylbutanoate?
The canonical SMILES for 9H-fluoren-9-ylmethyl 3-methylbutanoate is CC(C)CC(=O)OCC1c2ccccc2-c2ccccc21.
What is the InChIKey of 9H-fluoren-9-ylmethyl 3-methylbutanoate?
The InChIKey is DPHKUWFYURIUPZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H20O2/c1-13(2)11-19(20)21-12-18-16-9-5-3-7-14(16)15-8-4-6-10-17(15)18/h3-10,13,18H,11-12H2,1-2H3.
What are the key properties of 9H-fluoren-9-ylmethyl 3-methylbutanoate?
9H-fluoren-9-ylmethyl 3-methylbutanoate has a molecular weight of 280.37 g/mol, XLogP of 4.39, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 9H-fluoren-9-ylmethyl 3-methylbutanoate is sourced from PubChem (CID 22020159), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).