C13H12F6 — CID 22020362
9,10,10-trifluoro-9-(trifluoromethyl)tetracyclo[6.2.1.13,6.02,7]dodec-1-ene (PubChem CID 22020362) has the molecular formula C13H12F6 and a molecular weight of 282.23 g/mol. Its IUPAC name is 9,10,10-trifluoro-9-(trifluoromethyl)tetracyclo[6.2.1.13,6.02,7]dodec-1-ene.
| Compound Name | 9,10,10-trifluoro-9-(trifluoromethyl)tetracyclo[6.2.1.13,6.02,7]dodec-1-ene |
|---|---|
| PubChem CID | 22020362 |
| Molecular Formula | C13H12F6 |
| Molecular Weight | 282.23 g/mol |
| Exact Mass | 282.08 |
| IUPAC Name | 9,10,10-trifluoro-9-(trifluoromethyl)tetracyclo[6.2.1.13,6.02,7]dodec-1-ene |
| SMILES | FC(F)(F)C1(F)C2CC(=C3C4CCC(C4)C32)C1(F)F |
| InChI | InChI=1S/C13H12F6/c14-11(13(17,18)19)7-4-8(12(11,15)16)10-6-2-1-5(3-6)9(7)10/h5-7,9H,1-4H2 |
| InChIKey | BULSQKJQHCIZGT-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.23 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|