About 2,3-dihydro-1H-indole-5,6-diol;hydrobromide
2,3-dihydro-1H-indole-5,6-diol;hydrobromide (PubChem CID 22020437) has the molecular formula C8H10BrNO2
and a molecular weight of 232.08 g/mol. Its IUPAC name is 2,3-dihydro-1H-indole-5,6-diol;hydrobromide.
Molecular Properties
| Compound Name | 2,3-dihydro-1H-indole-5,6-diol;hydrobromide |
| PubChem CID | 22020437 |
| Molecular Formula | C8H10BrNO2 |
| Molecular Weight | 232.08 g/mol |
| Exact Mass | 230.99 |
| IUPAC Name | 2,3-dihydro-1H-indole-5,6-diol;hydrobromide |
| SMILES | Br.Oc1cc2c(cc1O)NCC2 |
| InChI | InChI=1S/C8H9NO2.BrH/c10-7-3-5-1-2-9-6(5)4-8(7)11;/h3-4,9-11H,1-2H2;1H |
| InChIKey | TXMQOPNBBITFNX-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.08 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|
Analyze 2,3-dihydro-1H-indole-5,6-diol;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dihydro-1H-indole-5,6-diol;hydrobromide?
The IUPAC name of 2,3-dihydro-1H-indole-5,6-diol;hydrobromide (CID 22020437) is 2,3-dihydro-1H-indole-5,6-diol;hydrobromide.
What is the SMILES notation for 2,3-dihydro-1H-indole-5,6-diol;hydrobromide?
The canonical SMILES for 2,3-dihydro-1H-indole-5,6-diol;hydrobromide is Br.Oc1cc2c(cc1O)NCC2.
What is the InChIKey of 2,3-dihydro-1H-indole-5,6-diol;hydrobromide?
The InChIKey is TXMQOPNBBITFNX-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9NO2.BrH/c10-7-3-5-1-2-9-6(5)4-8(7)11;/h3-4,9-11H,1-2H2;1H.
What are the key properties of 2,3-dihydro-1H-indole-5,6-diol;hydrobromide?
2,3-dihydro-1H-indole-5,6-diol;hydrobromide has a molecular weight of 232.08 g/mol, XLogP of 1.64, 0 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dihydro-1H-indole-5,6-diol;hydrobromide is sourced from PubChem (CID 22020437), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).