C26H26F13IO3S — CID 22020615
bis(2-tert-butylphenyl)iodanium;1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexane-1-sulfonate (PubChem CID 22020615) has the molecular formula C26H26F13IO3S and a molecular weight of 792.44 g/mol. Its IUPAC name is bis(2-tert-butylphenyl)iodanium;1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexane-1-sulfonate.
| Compound Name | bis(2-tert-butylphenyl)iodanium;1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexane-1-sulfonate |
|---|---|
| PubChem CID | 22020615 |
| Molecular Formula | C26H26F13IO3S |
| Molecular Weight | 792.44 g/mol |
| Exact Mass | 792.04 |
| IUPAC Name | bis(2-tert-butylphenyl)iodanium;1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexane-1-sulfonate |
| SMILES | CC(C)(C)c1ccccc1[I+]c1ccccc1C(C)(C)C.O=S(=O)([O-])C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C20H26I.C6HF13O3S/c1-19(2,3)15-11-7-9-13-17(15)21-18-14-10-8-12-16(18)20(4,5)6;7-1(8,3(11,12)5(15,16)17)2(9,10)4(13,14)6(18,19)23(20,21)22/h7-14H,1-6H3;(H,20,21,22)/q+1;/p-1 |
| InChIKey | JGBDZZPDMXIDQM-UHFFFAOYSA-M |
| XLogP | 5.64 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 792.44 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|