About 4,4-bis(butoxymethyl)-2,6-dimethylheptane
4,4-bis(butoxymethyl)-2,6-dimethylheptane (PubChem CID 22020667) has the molecular formula C19H40O2
and a molecular weight of 300.53 g/mol. Its IUPAC name is 4,4-bis(butoxymethyl)-2,6-dimethylheptane.
Molecular Properties
| Compound Name | 4,4-bis(butoxymethyl)-2,6-dimethylheptane |
| PubChem CID | 22020667 |
| Molecular Formula | C19H40O2 |
| Molecular Weight | 300.53 g/mol |
| Exact Mass | 300.30 |
| IUPAC Name | 4,4-bis(butoxymethyl)-2,6-dimethylheptane |
| SMILES | CCCCOCC(COCCCC)(CC(C)C)CC(C)C |
| InChI | InChI=1S/C19H40O2/c1-7-9-11-20-15-19(13-17(3)4,14-18(5)6)16-21-12-10-8-2/h17-18H,7-16H2,1-6H3 |
| InChIKey | PYHOSWIHPZRHDU-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 300.53 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4,4-bis(butoxymethyl)-2,6-dimethylheptane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,4-bis(butoxymethyl)-2,6-dimethylheptane?
The IUPAC name of 4,4-bis(butoxymethyl)-2,6-dimethylheptane (CID 22020667) is 4,4-bis(butoxymethyl)-2,6-dimethylheptane.
What is the SMILES notation for 4,4-bis(butoxymethyl)-2,6-dimethylheptane?
The canonical SMILES for 4,4-bis(butoxymethyl)-2,6-dimethylheptane is CCCCOCC(COCCCC)(CC(C)C)CC(C)C.
What is the InChIKey of 4,4-bis(butoxymethyl)-2,6-dimethylheptane?
The InChIKey is PYHOSWIHPZRHDU-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H40O2/c1-7-9-11-20-15-19(13-17(3)4,14-18(5)6)16-21-12-10-8-2/h17-18H,7-16H2,1-6H3.
What are the key properties of 4,4-bis(butoxymethyl)-2,6-dimethylheptane?
4,4-bis(butoxymethyl)-2,6-dimethylheptane has a molecular weight of 300.53 g/mol, XLogP of 5.70, 14 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4,4-bis(butoxymethyl)-2,6-dimethylheptane is sourced from PubChem (CID 22020667), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).