C15H25NO3Si — CID 22020938
tert-butyl-dimethyl-[(7-methyl-2,3-dihydro-[1,4]dioxino[2,3-b]pyridin-3-yl)methoxy]silane (PubChem CID 22020938) has the molecular formula C15H25NO3Si and a molecular weight of 295.45 g/mol. Its IUPAC name is tert-butyl-dimethyl-[(7-methyl-2,3-dihydro-[1,4]dioxino[2,3-b]pyridin-3-yl)methoxy]silane.
| Compound Name | tert-butyl-dimethyl-[(7-methyl-2,3-dihydro-[1,4]dioxino[2,3-b]pyridin-3-yl)methoxy]silane |
|---|---|
| PubChem CID | 22020938 |
| Molecular Formula | C15H25NO3Si |
| Molecular Weight | 295.45 g/mol |
| Exact Mass | 295.16 |
| IUPAC Name | tert-butyl-dimethyl-[(7-methyl-2,3-dihydro-[1,4]dioxino[2,3-b]pyridin-3-yl)methoxy]silane |
| SMILES | Cc1cnc2c(c1)OCC(CO[Si](C)(C)C(C)(C)C)O2 |
| InChI | InChI=1S/C15H25NO3Si/c1-11-7-13-14(16-8-11)19-12(9-17-13)10-18-20(5,6)15(2,3)4/h7-8,12H,9-10H2,1-6H3 |
| InChIKey | JXRLQHPJZUTEJM-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 40.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.45 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|