C9H5F9 — CID 22021815
1,3,5-tris(trifluoromethyl)cyclohexa-1,3-diene (PubChem CID 22021815) has the molecular formula C9H5F9 and a molecular weight of 284.12 g/mol. Its IUPAC name is 1,3,5-tris(trifluoromethyl)cyclohexa-1,3-diene.
| Compound Name | 1,3,5-tris(trifluoromethyl)cyclohexa-1,3-diene |
|---|---|
| PubChem CID | 22021815 |
| Molecular Formula | C9H5F9 |
| Molecular Weight | 284.12 g/mol |
| Exact Mass | 284.02 |
| IUPAC Name | 1,3,5-tris(trifluoromethyl)cyclohexa-1,3-diene |
| SMILES | FC(F)(F)C1=CC(C(F)(F)F)CC(C(F)(F)F)=C1 |
| InChI | InChI=1S/C9H5F9/c10-7(11,12)4-1-5(8(13,14)15)3-6(2-4)9(16,17)18/h1-2,5H,3H2 |
| InChIKey | NESJSJYEZHXEKH-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.12 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |