About 1-fluoro-3,5-bis(3-fluorophenoxy)benzene
1-fluoro-3,5-bis(3-fluorophenoxy)benzene (PubChem CID 22022525) has the molecular formula C18H11F3O2
and a molecular weight of 316.28 g/mol. Its IUPAC name is 1-fluoro-3,5-bis(3-fluorophenoxy)benzene.
Molecular Properties
| Compound Name | 1-fluoro-3,5-bis(3-fluorophenoxy)benzene |
| PubChem CID | 22022525 |
| Molecular Formula | C18H11F3O2 |
| Molecular Weight | 316.28 g/mol |
| Exact Mass | 316.07 |
| IUPAC Name | 1-fluoro-3,5-bis(3-fluorophenoxy)benzene |
| SMILES | Fc1cccc(Oc2cc(F)cc(Oc3cccc(F)c3)c2)c1 |
| InChI | InChI=1S/C18H11F3O2/c19-12-3-1-5-15(7-12)22-17-9-14(21)10-18(11-17)23-16-6-2-4-13(20)8-16/h1-11H |
| InChIKey | FENDQJATPANUFH-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 316.28 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-fluoro-3,5-bis(3-fluorophenoxy)benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-fluoro-3,5-bis(3-fluorophenoxy)benzene?
The IUPAC name of 1-fluoro-3,5-bis(3-fluorophenoxy)benzene (CID 22022525) is 1-fluoro-3,5-bis(3-fluorophenoxy)benzene.
What is the SMILES notation for 1-fluoro-3,5-bis(3-fluorophenoxy)benzene?
The canonical SMILES for 1-fluoro-3,5-bis(3-fluorophenoxy)benzene is Fc1cccc(Oc2cc(F)cc(Oc3cccc(F)c3)c2)c1.
What is the InChIKey of 1-fluoro-3,5-bis(3-fluorophenoxy)benzene?
The InChIKey is FENDQJATPANUFH-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H11F3O2/c19-12-3-1-5-15(7-12)22-17-9-14(21)10-18(11-17)23-16-6-2-4-13(20)8-16/h1-11H.
What are the key properties of 1-fluoro-3,5-bis(3-fluorophenoxy)benzene?
1-fluoro-3,5-bis(3-fluorophenoxy)benzene has a molecular weight of 316.28 g/mol, XLogP of 5.69, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-fluoro-3,5-bis(3-fluorophenoxy)benzene is sourced from PubChem (CID 22022525), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).