C12H32O3Si3 — CID 22022602
1,1,2-tris(trimethylsilyl)propane-1,2,3-triol (PubChem CID 22022602) has the molecular formula C12H32O3Si3 and a molecular weight of 308.64 g/mol. Its IUPAC name is 1,1,2-tris(trimethylsilyl)propane-1,2,3-triol.
| Compound Name | 1,1,2-tris(trimethylsilyl)propane-1,2,3-triol |
|---|---|
| PubChem CID | 22022602 |
| Molecular Formula | C12H32O3Si3 |
| Molecular Weight | 308.64 g/mol |
| Exact Mass | 308.17 |
| IUPAC Name | 1,1,2-tris(trimethylsilyl)propane-1,2,3-triol |
| SMILES | C[Si](C)(C)C(O)(CO)C(O)([Si](C)(C)C)[Si](C)(C)C |
| InChI | InChI=1S/C12H32O3Si3/c1-16(2,3)11(14,10-13)12(15,17(4,5)6)18(7,8)9/h13-15H,10H2,1-9H3 |
| InChIKey | MPSCKVALZAUZJC-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.64 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|