C10H4F12 — CID 22022755
1,2,4,5-tetrakis(trifluoromethyl)cyclohexa-1,4-diene (PubChem CID 22022755) has the molecular formula C10H4F12 and a molecular weight of 352.12 g/mol. Its IUPAC name is 1,2,4,5-tetrakis(trifluoromethyl)cyclohexa-1,4-diene.
| Compound Name | 1,2,4,5-tetrakis(trifluoromethyl)cyclohexa-1,4-diene |
|---|---|
| PubChem CID | 22022755 |
| Molecular Formula | C10H4F12 |
| Molecular Weight | 352.12 g/mol |
| Exact Mass | 352.01 |
| IUPAC Name | 1,2,4,5-tetrakis(trifluoromethyl)cyclohexa-1,4-diene |
| SMILES | FC(F)(F)C1=C(C(F)(F)F)CC(C(F)(F)F)=C(C(F)(F)F)C1 |
| InChI | InChI=1S/C10H4F12/c11-7(12,13)3-1-4(8(14,15)16)6(10(20,21)22)2-5(3)9(17,18)19/h1-2H2 |
| InChIKey | OUULTNSBKYQFNE-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.12 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|