About pyridine-3,4-diimine
pyridine-3,4-diimine (PubChem CID 22022782) has the molecular formula C5H5N3
and a molecular weight of 107.12 g/mol. Its IUPAC name is pyridine-3,4-diimine.
Molecular Properties
| Compound Name | pyridine-3,4-diimine |
| PubChem CID | 22022782 |
| Molecular Formula | C5H5N3 |
| Molecular Weight | 107.12 g/mol |
| Exact Mass | 107.05 |
| IUPAC Name | pyridine-3,4-diimine |
| SMILES | [H]/N=C1\C=CN=C\C1=N/[H] |
| InChI | InChI=1S/C5H5N3/c6-4-1-2-8-3-5(4)7/h1-3,6-7H/b6-4+,7-5+ |
| InChIKey | OAEZGXIIOIHYON-YDFGWWAZSA-N |
| XLogP | 0.62 |
| TPSA | 60.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 107.12 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze pyridine-3,4-diimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyridine-3,4-diimine?
The IUPAC name of pyridine-3,4-diimine (CID 22022782) is pyridine-3,4-diimine.
What is the SMILES notation for pyridine-3,4-diimine?
The canonical SMILES for pyridine-3,4-diimine is [H]/N=C1\C=CN=C\C1=N/[H].
What is the InChIKey of pyridine-3,4-diimine?
The InChIKey is OAEZGXIIOIHYON-YDFGWWAZSA-N. The full InChI is InChI=1S/C5H5N3/c6-4-1-2-8-3-5(4)7/h1-3,6-7H/b6-4+,7-5+.
What are the key properties of pyridine-3,4-diimine?
pyridine-3,4-diimine has a molecular weight of 107.12 g/mol, XLogP of 0.62, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for pyridine-3,4-diimine is sourced from PubChem (CID 22022782), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).