C26H26N4O5 — CID 2202323
[4-[(4R)-6-amino-5-cyano-3-propyl-2,4-dihydropyrano[2,3-c]pyrazol-4-yl]-2-ethoxyphenyl] 3-methoxybenzoate (PubChem CID 2202323) has the molecular formula C26H26N4O5 and a molecular weight of 474.52 g/mol. Its IUPAC name is [4-[(4R)-6-amino-5-cyano-3-propyl-2,4-dihydropyrano[2,3-c]pyrazol-4-yl]-2-ethoxyphenyl] 3-methoxybenzoate.
| Compound Name | [4-[(4R)-6-amino-5-cyano-3-propyl-2,4-dihydropyrano[2,3-c]pyrazol-4-yl]-2-ethoxyphenyl] 3-methoxybenzoate |
|---|---|
| PubChem CID | 2202323 |
| Molecular Formula | C26H26N4O5 |
| Molecular Weight | 474.52 g/mol |
| Exact Mass | 474.19 |
| IUPAC Name | [4-[(4R)-6-amino-5-cyano-3-propyl-2,4-dihydropyrano[2,3-c]pyrazol-4-yl]-2-ethoxyphenyl] 3-methoxybenzoate |
| SMILES | CCCc1[nH]nc2c1[C@H](c1ccc(OC(=O)c3cccc(OC)c3)c(OCC)c1)C(C#N)=C(N)O2 |
| InChI | InChI=1S/C26H26N4O5/c1-4-7-19-23-22(18(14-27)24(28)35-25(23)30-29-19)15-10-11-20(21(13-15)33-5-2)34-26(31)16-8-6-9-17(12-16)32-3/h6,8-13,22H,4-5,7,28H2,1-3H3,(H,29,30)/t22-/m1/s1 |
| InChIKey | MKCIBIJISBYMGQ-JOCHJYFZSA-N |
| XLogP | 4.21 |
| TPSA | 132.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.52 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|