About 6-fluoro-3-[1-[3-(1H-indol-7-yloxy)phenyl]piperidin-4-yl]-1,2-benzoxazole
6-fluoro-3-[1-[3-(1H-indol-7-yloxy)phenyl]piperidin-4-yl]-1,2-benzoxazole (PubChem CID 22023238) has the molecular formula C26H22FN3O2
and a molecular weight of 427.48 g/mol. Its IUPAC name is 6-fluoro-3-[1-[3-(1H-indol-7-yloxy)phenyl]piperidin-4-yl]-1,2-benzoxazole.
Molecular Properties
| Compound Name | 6-fluoro-3-[1-[3-(1H-indol-7-yloxy)phenyl]piperidin-4-yl]-1,2-benzoxazole |
| PubChem CID | 22023238 |
| Molecular Formula | C26H22FN3O2 |
| Molecular Weight | 427.48 g/mol |
| Exact Mass | 427.17 |
| IUPAC Name | 6-fluoro-3-[1-[3-(1H-indol-7-yloxy)phenyl]piperidin-4-yl]-1,2-benzoxazole |
| SMILES | Fc1ccc2c(C3CCN(c4cccc(Oc5cccc6cc[nH]c56)c4)CC3)noc2c1 |
| InChI | InChI=1S/C26H22FN3O2/c27-19-7-8-22-24(15-19)32-29-25(22)18-10-13-30(14-11-18)20-4-2-5-21(16-20)31-23-6-1-3-17-9-12-28-26(17)23/h1-9,12,15-16,18,28H,10-11,13-14H2 |
| InChIKey | KIXTVKPJBDNOIJ-UHFFFAOYSA-N |
| XLogP | 6.62 |
| TPSA | 54.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 427.48 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-fluoro-3-[1-[3-(1H-indol-7-yloxy)phenyl]piperidin-4-yl]-1,2-benzoxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-fluoro-3-[1-[3-(1H-indol-7-yloxy)phenyl]piperidin-4-yl]-1,2-benzoxazole?
The IUPAC name of 6-fluoro-3-[1-[3-(1H-indol-7-yloxy)phenyl]piperidin-4-yl]-1,2-benzoxazole (CID 22023238) is 6-fluoro-3-[1-[3-(1H-indol-7-yloxy)phenyl]piperidin-4-yl]-1,2-benzoxazole.
What is the SMILES notation for 6-fluoro-3-[1-[3-(1H-indol-7-yloxy)phenyl]piperidin-4-yl]-1,2-benzoxazole?
The canonical SMILES for 6-fluoro-3-[1-[3-(1H-indol-7-yloxy)phenyl]piperidin-4-yl]-1,2-benzoxazole is Fc1ccc2c(C3CCN(c4cccc(Oc5cccc6cc[nH]c56)c4)CC3)noc2c1.
What is the InChIKey of 6-fluoro-3-[1-[3-(1H-indol-7-yloxy)phenyl]piperidin-4-yl]-1,2-benzoxazole?
The InChIKey is KIXTVKPJBDNOIJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H22FN3O2/c27-19-7-8-22-24(15-19)32-29-25(22)18-10-13-30(14-11-18)20-4-2-5-21(16-20)31-23-6-1-3-17-9-12-28-26(17)23/h1-9,12,15-16,18,28H,10-11,13-14H2.
What are the key properties of 6-fluoro-3-[1-[3-(1H-indol-7-yloxy)phenyl]piperidin-4-yl]-1,2-benzoxazole?
6-fluoro-3-[1-[3-(1H-indol-7-yloxy)phenyl]piperidin-4-yl]-1,2-benzoxazole has a molecular weight of 427.48 g/mol, XLogP of 6.62, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-fluoro-3-[1-[3-(1H-indol-7-yloxy)phenyl]piperidin-4-yl]-1,2-benzoxazole is sourced from PubChem (CID 22023238), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).