2-[2-(2-hydroxyethoxy)ethoxy]acetic acid

C6H12O5 — CID 22023490

IUPAC2-[2-(2-hydroxyethoxy)ethoxy]acetic acid
SMILESO=C(O)COCCOCCO
InChIInChI=1S/C6H12O5/c7-1-2-10-3-4-11-5-6(8)9/h7H,1-5H2,(H,8,9)
InChIKeyPRBXPAHXMGDVNQ-UHFFFAOYSA-N
MW164.16 g/mol
LogP-0.90
Rot. Bonds7

About 2-[2-(2-hydroxyethoxy)ethoxy]acetic acid

2-[2-(2-hydroxyethoxy)ethoxy]acetic acid (PubChem CID 22023490) has the molecular formula C6H12O5 and a molecular weight of 164.16 g/mol. Its IUPAC name is 2-[2-(2-hydroxyethoxy)ethoxy]acetic acid.

Molecular Properties

Compound Name2-[2-(2-hydroxyethoxy)ethoxy]acetic acid
PubChem CID22023490
Molecular FormulaC6H12O5
Molecular Weight164.16 g/mol
Exact Mass164.07
IUPAC Name2-[2-(2-hydroxyethoxy)ethoxy]acetic acid
SMILESO=C(O)COCCOCCO
InChIInChI=1S/C6H12O5/c7-1-2-10-3-4-11-5-6(8)9/h7H,1-5H2,(H,8,9)
InChIKeyPRBXPAHXMGDVNQ-UHFFFAOYSA-N
XLogP-0.90
TPSA75.99 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds7
Heavy Atoms11
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500164.16
LogP ≤ 5-0.90
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze 2-[2-(2-hydroxyethoxy)ethoxy]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[2-(2-hydroxyethoxy)ethoxy]acetic acid?
The IUPAC name of 2-[2-(2-hydroxyethoxy)ethoxy]acetic acid (CID 22023490) is 2-[2-(2-hydroxyethoxy)ethoxy]acetic acid.
What is the SMILES notation for 2-[2-(2-hydroxyethoxy)ethoxy]acetic acid?
The canonical SMILES for 2-[2-(2-hydroxyethoxy)ethoxy]acetic acid is O=C(O)COCCOCCO.
What is the InChIKey of 2-[2-(2-hydroxyethoxy)ethoxy]acetic acid?
The InChIKey is PRBXPAHXMGDVNQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12O5/c7-1-2-10-3-4-11-5-6(8)9/h7H,1-5H2,(H,8,9).
What are the key properties of 2-[2-(2-hydroxyethoxy)ethoxy]acetic acid?
2-[2-(2-hydroxyethoxy)ethoxy]acetic acid has a molecular weight of 164.16 g/mol, XLogP of -0.90, 7 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(2-hydroxyethoxy)ethoxy]acetic acid is sourced from PubChem (CID 22023490), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).