C20H30Ti — CID 22023607
bis(1,2,3,5,5-pentamethylcyclopenta-1,3-diene);titanium(2+) (PubChem CID 22023607) has the molecular formula C20H30Ti and a molecular weight of 318.33 g/mol. Its IUPAC name is bis(1,2,3,5,5-pentamethylcyclopenta-1,3-diene);titanium(2+).
| Compound Name | bis(1,2,3,5,5-pentamethylcyclopenta-1,3-diene);titanium(2+) |
|---|---|
| PubChem CID | 22023607 |
| Molecular Formula | C20H30Ti |
| Molecular Weight | 318.33 g/mol |
| Exact Mass | 318.18 |
| IUPAC Name | bis(1,2,3,5,5-pentamethylcyclopenta-1,3-diene);titanium(2+) |
| SMILES | CC1=[C-]C(C)(C)C(C)=C1C.CC1=[C-]C(C)(C)C(C)=C1C.[Ti+2] |
| InChI | InChI=1S/2C10H15.Ti/c2*1-7-6-10(4,5)9(3)8(7)2;/h2*1-5H3;/q2*-1;+2 |
| InChIKey | ORVBNYNCRLHZOL-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.33 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|