About titanium(2+);toluene
titanium(2+);toluene (PubChem CID 22023820) has the molecular formula C14H16Ti+2
and a molecular weight of 232.15 g/mol. Its IUPAC name is titanium(2+);toluene.
Molecular Properties
| Compound Name | titanium(2+);toluene |
| PubChem CID | 22023820 |
| Molecular Formula | C14H16Ti+2 |
| Molecular Weight | 232.15 g/mol |
| Exact Mass | 232.07 |
| IUPAC Name | titanium(2+);toluene |
| SMILES | Cc1ccccc1.Cc1ccccc1.[Ti+2] |
| InChI | InChI=1S/2C7H8.Ti/c2*1-7-5-3-2-4-6-7;/h2*2-6H,1H3;/q;;+2 |
| InChIKey | BGDNNOVTPDMYSZ-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.15 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze titanium(2+);toluene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of titanium(2+);toluene?
The IUPAC name of titanium(2+);toluene (CID 22023820) is titanium(2+);toluene.
What is the SMILES notation for titanium(2+);toluene?
The canonical SMILES for titanium(2+);toluene is Cc1ccccc1.Cc1ccccc1.[Ti+2].
What is the InChIKey of titanium(2+);toluene?
The InChIKey is BGDNNOVTPDMYSZ-UHFFFAOYSA-N. The full InChI is InChI=1S/2C7H8.Ti/c2*1-7-5-3-2-4-6-7;/h2*2-6H,1H3;/q;;+2.
What are the key properties of titanium(2+);toluene?
titanium(2+);toluene has a molecular weight of 232.15 g/mol, XLogP of 3.99, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for titanium(2+);toluene is sourced from PubChem (CID 22023820), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).