About 1-cyclohexyloxyethyl 2-methylbicyclo[2.2.1]hept-5-ene-2-carboxylate
1-cyclohexyloxyethyl 2-methylbicyclo[2.2.1]hept-5-ene-2-carboxylate (PubChem CID 22023907) has the molecular formula C17H26O3
and a molecular weight of 278.39 g/mol. Its IUPAC name is 1-cyclohexyloxyethyl 2-methylbicyclo[2.2.1]hept-5-ene-2-carboxylate.
Molecular Properties
| Compound Name | 1-cyclohexyloxyethyl 2-methylbicyclo[2.2.1]hept-5-ene-2-carboxylate |
| PubChem CID | 22023907 |
| Molecular Formula | C17H26O3 |
| Molecular Weight | 278.39 g/mol |
| Exact Mass | 278.19 |
| IUPAC Name | 1-cyclohexyloxyethyl 2-methylbicyclo[2.2.1]hept-5-ene-2-carboxylate |
| SMILES | CC(OC(=O)C1(C)CC2C=CC1C2)OC1CCCCC1 |
| InChI | InChI=1S/C17H26O3/c1-12(19-15-6-4-3-5-7-15)20-16(18)17(2)11-13-8-9-14(17)10-13/h8-9,12-15H,3-7,10-11H2,1-2H3 |
| InChIKey | PKPYDRWNMWEQTA-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.39 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-cyclohexyloxyethyl 2-methylbicyclo[2.2.1]hept-5-ene-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclohexyloxyethyl 2-methylbicyclo[2.2.1]hept-5-ene-2-carboxylate?
The IUPAC name of 1-cyclohexyloxyethyl 2-methylbicyclo[2.2.1]hept-5-ene-2-carboxylate (CID 22023907) is 1-cyclohexyloxyethyl 2-methylbicyclo[2.2.1]hept-5-ene-2-carboxylate.
What is the SMILES notation for 1-cyclohexyloxyethyl 2-methylbicyclo[2.2.1]hept-5-ene-2-carboxylate?
The canonical SMILES for 1-cyclohexyloxyethyl 2-methylbicyclo[2.2.1]hept-5-ene-2-carboxylate is CC(OC(=O)C1(C)CC2C=CC1C2)OC1CCCCC1.
What is the InChIKey of 1-cyclohexyloxyethyl 2-methylbicyclo[2.2.1]hept-5-ene-2-carboxylate?
The InChIKey is PKPYDRWNMWEQTA-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H26O3/c1-12(19-15-6-4-3-5-7-15)20-16(18)17(2)11-13-8-9-14(17)10-13/h8-9,12-15H,3-7,10-11H2,1-2H3.
What are the key properties of 1-cyclohexyloxyethyl 2-methylbicyclo[2.2.1]hept-5-ene-2-carboxylate?
1-cyclohexyloxyethyl 2-methylbicyclo[2.2.1]hept-5-ene-2-carboxylate has a molecular weight of 278.39 g/mol, XLogP of 3.83, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclohexyloxyethyl 2-methylbicyclo[2.2.1]hept-5-ene-2-carboxylate is sourced from PubChem (CID 22023907), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).