C10H11F3O2 — CID 22023936
2,2,2-trifluoroethyl bicyclo[2.2.1]hept-5-ene-2-carboxylate (PubChem CID 22023936) has the molecular formula C10H11F3O2 and a molecular weight of 220.19 g/mol. Its IUPAC name is 2,2,2-trifluoroethyl bicyclo[2.2.1]hept-5-ene-2-carboxylate.
| Compound Name | 2,2,2-trifluoroethyl bicyclo[2.2.1]hept-5-ene-2-carboxylate |
|---|---|
| PubChem CID | 22023936 |
| Molecular Formula | C10H11F3O2 |
| Molecular Weight | 220.19 g/mol |
| Exact Mass | 220.07 |
| IUPAC Name | 2,2,2-trifluoroethyl bicyclo[2.2.1]hept-5-ene-2-carboxylate |
| SMILES | O=C(OCC(F)(F)F)C1CC2C=CC1C2 |
| InChI | InChI=1S/C10H11F3O2/c11-10(12,13)5-15-9(14)8-4-6-1-2-7(8)3-6/h1-2,6-8H,3-5H2 |
| InChIKey | JCEBJANJSMTYJD-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.19 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|