C49H38F3NO2 — CID 22023977
4-[(4-fluorophenyl)-[9-(4-fluorophenyl)-7-[(4-fluorophenyl)-(4-hydroxy-3,5-dimethylphenyl)methyl]acridin-2-yl]methyl]-2,6-dimethylphenol (PubChem CID 22023977) has the molecular formula C49H38F3NO2 and a molecular weight of 729.84 g/mol. Its IUPAC name is 4-[(4-fluorophenyl)-[9-(4-fluorophenyl)-7-[(4-fluorophenyl)-(4-hydroxy-3,5-dimethylphenyl)methyl]acridin-2-yl]methyl]-2,6-dimethylphenol.
| Compound Name | 4-[(4-fluorophenyl)-[9-(4-fluorophenyl)-7-[(4-fluorophenyl)-(4-hydroxy-3,5-dimethylphenyl)methyl]acridin-2-yl]methyl]-2,6-dimethylphenol |
|---|---|
| PubChem CID | 22023977 |
| Molecular Formula | C49H38F3NO2 |
| Molecular Weight | 729.84 g/mol |
| Exact Mass | 729.29 |
| IUPAC Name | 4-[(4-fluorophenyl)-[9-(4-fluorophenyl)-7-[(4-fluorophenyl)-(4-hydroxy-3,5-dimethylphenyl)methyl]acridin-2-yl]methyl]-2,6-dimethylphenol |
| SMILES | Cc1cc(C(c2ccc(F)cc2)c2ccc3nc4ccc(C(c5ccc(F)cc5)c5cc(C)c(O)c(C)c5)cc4c(-c4ccc(F)cc4)c3c2)cc(C)c1O |
| InChI | InChI=1S/C49H38F3NO2/c1-27-21-36(22-28(2)48(27)54)45(31-5-13-38(50)14-6-31)34-11-19-43-41(25-34)47(33-9-17-40(52)18-10-33)42-26-35(12-20-44(42)53-43)46(32-7-15-39(51)16-8-32)37-23-29(3)49(55)30(4)24-37/h5-26,45-46,54-55H,1-4H3 |
| InChIKey | JVYNPVQMGAYANW-UHFFFAOYSA-N |
| XLogP | 12.48 |
| TPSA | 53.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 729.84 |
| LogP ≤ 5 | 12.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|