About 2-amino-3-sulfanylphenol
2-amino-3-sulfanylphenol (PubChem CID 22024181) has the molecular formula C6H7NOS
and a molecular weight of 141.19 g/mol. Its IUPAC name is 2-amino-3-sulfanylphenol.
Molecular Properties
| Compound Name | 2-amino-3-sulfanylphenol |
| PubChem CID | 22024181 |
| Molecular Formula | C6H7NOS |
| Molecular Weight | 141.19 g/mol |
| Exact Mass | 141.02 |
| IUPAC Name | 2-amino-3-sulfanylphenol |
| SMILES | Nc1c(O)cccc1S |
| InChI | InChI=1S/C6H7NOS/c7-6-4(8)2-1-3-5(6)9/h1-3,8-9H,7H2 |
| InChIKey | FPFQSTOZKORBST-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 141.19 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-3-sulfanylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-3-sulfanylphenol?
The IUPAC name of 2-amino-3-sulfanylphenol (CID 22024181) is 2-amino-3-sulfanylphenol.
What is the SMILES notation for 2-amino-3-sulfanylphenol?
The canonical SMILES for 2-amino-3-sulfanylphenol is Nc1c(O)cccc1S.
What is the InChIKey of 2-amino-3-sulfanylphenol?
The InChIKey is FPFQSTOZKORBST-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7NOS/c7-6-4(8)2-1-3-5(6)9/h1-3,8-9H,7H2.
What are the key properties of 2-amino-3-sulfanylphenol?
2-amino-3-sulfanylphenol has a molecular weight of 141.19 g/mol, XLogP of 1.26, 0 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-3-sulfanylphenol is sourced from PubChem (CID 22024181), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).