About 8-(2,4-dichlorophenyl)-3-(1-ethoxybutyl)-2-methylsulfanylimidazo[1,2-a]pyrazine
8-(2,4-dichlorophenyl)-3-(1-ethoxybutyl)-2-methylsulfanylimidazo[1,2-a]pyrazine (PubChem CID 22024491) has the molecular formula C19H21Cl2N3OS
and a molecular weight of 410.37 g/mol. Its IUPAC name is 8-(2,4-dichlorophenyl)-3-(1-ethoxybutyl)-2-methylsulfanylimidazo[1,2-a]pyrazine.
Molecular Properties
| Compound Name | 8-(2,4-dichlorophenyl)-3-(1-ethoxybutyl)-2-methylsulfanylimidazo[1,2-a]pyrazine |
| PubChem CID | 22024491 |
| Molecular Formula | C19H21Cl2N3OS |
| Molecular Weight | 410.37 g/mol |
| Exact Mass | 409.08 |
| IUPAC Name | 8-(2,4-dichlorophenyl)-3-(1-ethoxybutyl)-2-methylsulfanylimidazo[1,2-a]pyrazine |
| SMILES | CCCC(OCC)c1c(SC)nc2c(-c3ccc(Cl)cc3Cl)nccn12 |
| InChI | InChI=1S/C19H21Cl2N3OS/c1-4-6-15(25-5-2)17-19(26-3)23-18-16(22-9-10-24(17)18)13-8-7-12(20)11-14(13)21/h7-11,15H,4-6H2,1-3H3 |
| InChIKey | OXHSPHYZGIXZHU-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 39.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 410.37 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 8-(2,4-dichlorophenyl)-3-(1-ethoxybutyl)-2-methylsulfanylimidazo[1,2-a]pyrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-(2,4-dichlorophenyl)-3-(1-ethoxybutyl)-2-methylsulfanylimidazo[1,2-a]pyrazine?
The IUPAC name of 8-(2,4-dichlorophenyl)-3-(1-ethoxybutyl)-2-methylsulfanylimidazo[1,2-a]pyrazine (CID 22024491) is 8-(2,4-dichlorophenyl)-3-(1-ethoxybutyl)-2-methylsulfanylimidazo[1,2-a]pyrazine.
What is the SMILES notation for 8-(2,4-dichlorophenyl)-3-(1-ethoxybutyl)-2-methylsulfanylimidazo[1,2-a]pyrazine?
The canonical SMILES for 8-(2,4-dichlorophenyl)-3-(1-ethoxybutyl)-2-methylsulfanylimidazo[1,2-a]pyrazine is CCCC(OCC)c1c(SC)nc2c(-c3ccc(Cl)cc3Cl)nccn12.
What is the InChIKey of 8-(2,4-dichlorophenyl)-3-(1-ethoxybutyl)-2-methylsulfanylimidazo[1,2-a]pyrazine?
The InChIKey is OXHSPHYZGIXZHU-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H21Cl2N3OS/c1-4-6-15(25-5-2)17-19(26-3)23-18-16(22-9-10-24(17)18)13-8-7-12(20)11-14(13)21/h7-11,15H,4-6H2,1-3H3.
What are the key properties of 8-(2,4-dichlorophenyl)-3-(1-ethoxybutyl)-2-methylsulfanylimidazo[1,2-a]pyrazine?
8-(2,4-dichlorophenyl)-3-(1-ethoxybutyl)-2-methylsulfanylimidazo[1,2-a]pyrazine has a molecular weight of 410.37 g/mol, XLogP of 6.30, 7 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 8-(2,4-dichlorophenyl)-3-(1-ethoxybutyl)-2-methylsulfanylimidazo[1,2-a]pyrazine is sourced from PubChem (CID 22024491), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).