C9H8ClN3O — CID 22024515
8-chloro-2-ethylimidazo[1,2-a]pyrazine-3-carbaldehyde (PubChem CID 22024515) has the molecular formula C9H8ClN3O and a molecular weight of 209.64 g/mol. Its IUPAC name is 8-chloro-2-ethylimidazo[1,2-a]pyrazine-3-carbaldehyde.
| Compound Name | 8-chloro-2-ethylimidazo[1,2-a]pyrazine-3-carbaldehyde |
|---|---|
| PubChem CID | 22024515 |
| Molecular Formula | C9H8ClN3O |
| Molecular Weight | 209.64 g/mol |
| Exact Mass | 209.04 |
| IUPAC Name | 8-chloro-2-ethylimidazo[1,2-a]pyrazine-3-carbaldehyde |
| SMILES | CCc1nc2c(Cl)nccn2c1C=O |
| InChI | InChI=1S/C9H8ClN3O/c1-2-6-7(5-14)13-4-3-11-8(10)9(13)12-6/h3-5H,2H2,1H3 |
| InChIKey | ABSCTSTVCRSLSG-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 47.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.64 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|