About 2-(hydroxymethyl)-1,3-thiazole-5-carboxylic acid
2-(hydroxymethyl)-1,3-thiazole-5-carboxylic acid (PubChem CID 22025292) has the molecular formula C5H5NO3S
and a molecular weight of 159.17 g/mol. Its IUPAC name is 2-(hydroxymethyl)-1,3-thiazole-5-carboxylic acid.
Molecular Properties
| Compound Name | 2-(hydroxymethyl)-1,3-thiazole-5-carboxylic acid |
| PubChem CID | 22025292 |
| Molecular Formula | C5H5NO3S |
| Molecular Weight | 159.17 g/mol |
| Exact Mass | 159.00 |
| IUPAC Name | 2-(hydroxymethyl)-1,3-thiazole-5-carboxylic acid |
| SMILES | O=C(O)c1cnc(CO)s1 |
| InChI | InChI=1S/C5H5NO3S/c7-2-4-6-1-3(10-4)5(8)9/h1,7H,2H2,(H,8,9) |
| InChIKey | OPSZXGOORISTNR-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 70.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 159.17 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(hydroxymethyl)-1,3-thiazole-5-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(hydroxymethyl)-1,3-thiazole-5-carboxylic acid?
The IUPAC name of 2-(hydroxymethyl)-1,3-thiazole-5-carboxylic acid (CID 22025292) is 2-(hydroxymethyl)-1,3-thiazole-5-carboxylic acid.
What is the SMILES notation for 2-(hydroxymethyl)-1,3-thiazole-5-carboxylic acid?
The canonical SMILES for 2-(hydroxymethyl)-1,3-thiazole-5-carboxylic acid is O=C(O)c1cnc(CO)s1.
What is the InChIKey of 2-(hydroxymethyl)-1,3-thiazole-5-carboxylic acid?
The InChIKey is OPSZXGOORISTNR-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H5NO3S/c7-2-4-6-1-3(10-4)5(8)9/h1,7H,2H2,(H,8,9).
What are the key properties of 2-(hydroxymethyl)-1,3-thiazole-5-carboxylic acid?
2-(hydroxymethyl)-1,3-thiazole-5-carboxylic acid has a molecular weight of 159.17 g/mol, XLogP of 0.33, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(hydroxymethyl)-1,3-thiazole-5-carboxylic acid is sourced from PubChem (CID 22025292), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).