5,7-dimethylindolo[2,3-b]carbazole-6-carboxylic acid

C21H16N2O2 — CID 22025405

IUPAC5,7-dimethylindolo[2,3-b]carbazole-6-carboxylic acid
SMILESCn1c2ccccc2c2cc3c4ccccc4n(C)c3c(C(=O)O)c21
InChIInChI=1S/C21H16N2O2/c1-22-16-9-5-3-7-12(16)14-11-15-13-8-4-6-10-17(13)23(2)20(15)18(19(14)22)21(24)25/h3-11H,1-2H3,(H,24,25)
InChIKeyRFIOCAKLFBCGNB-UHFFFAOYSA-N
MW328.37 g/mol
LogP4.67
Rot. Bonds1

About 5,7-dimethylindolo[2,3-b]carbazole-6-carboxylic acid

5,7-dimethylindolo[2,3-b]carbazole-6-carboxylic acid (PubChem CID 22025405) has the molecular formula C21H16N2O2 and a molecular weight of 328.37 g/mol. Its IUPAC name is 5,7-dimethylindolo[2,3-b]carbazole-6-carboxylic acid.

Molecular Properties

Compound Name5,7-dimethylindolo[2,3-b]carbazole-6-carboxylic acid
PubChem CID22025405
Molecular FormulaC21H16N2O2
Molecular Weight328.37 g/mol
Exact Mass328.12
IUPAC Name5,7-dimethylindolo[2,3-b]carbazole-6-carboxylic acid
SMILESCn1c2ccccc2c2cc3c4ccccc4n(C)c3c(C(=O)O)c21
InChIInChI=1S/C21H16N2O2/c1-22-16-9-5-3-7-12(16)14-11-15-13-8-4-6-10-17(13)23(2)20(15)18(19(14)22)21(24)25/h3-11H,1-2H3,(H,24,25)
InChIKeyRFIOCAKLFBCGNB-UHFFFAOYSA-N
XLogP4.67
TPSA47.16 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms25
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500328.37
LogP ≤ 54.67
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 5,7-dimethylindolo[2,3-b]carbazole-6-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5,7-dimethylindolo[2,3-b]carbazole-6-carboxylic acid?
The IUPAC name of 5,7-dimethylindolo[2,3-b]carbazole-6-carboxylic acid (CID 22025405) is 5,7-dimethylindolo[2,3-b]carbazole-6-carboxylic acid.
What is the SMILES notation for 5,7-dimethylindolo[2,3-b]carbazole-6-carboxylic acid?
The canonical SMILES for 5,7-dimethylindolo[2,3-b]carbazole-6-carboxylic acid is Cn1c2ccccc2c2cc3c4ccccc4n(C)c3c(C(=O)O)c21.
What is the InChIKey of 5,7-dimethylindolo[2,3-b]carbazole-6-carboxylic acid?
The InChIKey is RFIOCAKLFBCGNB-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H16N2O2/c1-22-16-9-5-3-7-12(16)14-11-15-13-8-4-6-10-17(13)23(2)20(15)18(19(14)22)21(24)25/h3-11H,1-2H3,(H,24,25).
What are the key properties of 5,7-dimethylindolo[2,3-b]carbazole-6-carboxylic acid?
5,7-dimethylindolo[2,3-b]carbazole-6-carboxylic acid has a molecular weight of 328.37 g/mol, XLogP of 4.67, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5,7-dimethylindolo[2,3-b]carbazole-6-carboxylic acid is sourced from PubChem (CID 22025405), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).