About O-(2,2-dimethyl-1,3-dioxan-5-yl)hydroxylamine
O-(2,2-dimethyl-1,3-dioxan-5-yl)hydroxylamine (PubChem CID 22025693) has the molecular formula C6H13NO3
and a molecular weight of 147.17 g/mol. Its IUPAC name is O-(2,2-dimethyl-1,3-dioxan-5-yl)hydroxylamine.
Molecular Properties
| Compound Name | O-(2,2-dimethyl-1,3-dioxan-5-yl)hydroxylamine |
| PubChem CID | 22025693 |
| Molecular Formula | C6H13NO3 |
| Molecular Weight | 147.17 g/mol |
| Exact Mass | 147.09 |
| IUPAC Name | O-(2,2-dimethyl-1,3-dioxan-5-yl)hydroxylamine |
| SMILES | CC1(C)OCC(ON)CO1 |
| InChI | InChI=1S/C6H13NO3/c1-6(2)8-3-5(10-7)4-9-6/h5H,3-4,7H2,1-2H3 |
| InChIKey | CNKLVDBLWSVDNZ-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 147.17 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze O-(2,2-dimethyl-1,3-dioxan-5-yl)hydroxylamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of O-(2,2-dimethyl-1,3-dioxan-5-yl)hydroxylamine?
The IUPAC name of O-(2,2-dimethyl-1,3-dioxan-5-yl)hydroxylamine (CID 22025693) is O-(2,2-dimethyl-1,3-dioxan-5-yl)hydroxylamine.
What is the SMILES notation for O-(2,2-dimethyl-1,3-dioxan-5-yl)hydroxylamine?
The canonical SMILES for O-(2,2-dimethyl-1,3-dioxan-5-yl)hydroxylamine is CC1(C)OCC(ON)CO1.
What is the InChIKey of O-(2,2-dimethyl-1,3-dioxan-5-yl)hydroxylamine?
The InChIKey is CNKLVDBLWSVDNZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H13NO3/c1-6(2)8-3-5(10-7)4-9-6/h5H,3-4,7H2,1-2H3.
What are the key properties of O-(2,2-dimethyl-1,3-dioxan-5-yl)hydroxylamine?
O-(2,2-dimethyl-1,3-dioxan-5-yl)hydroxylamine has a molecular weight of 147.17 g/mol, XLogP of 0.03, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for O-(2,2-dimethyl-1,3-dioxan-5-yl)hydroxylamine is sourced from PubChem (CID 22025693), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).