About 2,5-dihydro-1,2-benzothiazepine
2,5-dihydro-1,2-benzothiazepine (PubChem CID 22025886) has the molecular formula C9H9NS
and a molecular weight of 163.25 g/mol. Its IUPAC name is 2,5-dihydro-1,2-benzothiazepine.
Molecular Properties
| Compound Name | 2,5-dihydro-1,2-benzothiazepine |
| PubChem CID | 22025886 |
| Molecular Formula | C9H9NS |
| Molecular Weight | 163.25 g/mol |
| Exact Mass | 163.05 |
| IUPAC Name | 2,5-dihydro-1,2-benzothiazepine |
| SMILES | C1=CNSc2ccccc2C1 |
| InChI | InChI=1S/C9H9NS/c1-2-6-9-8(4-1)5-3-7-10-11-9/h1-4,6-7,10H,5H2 |
| InChIKey | JHDXBQQGTRRSIX-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.25 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2,5-dihydro-1,2-benzothiazepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,5-dihydro-1,2-benzothiazepine?
The IUPAC name of 2,5-dihydro-1,2-benzothiazepine (CID 22025886) is 2,5-dihydro-1,2-benzothiazepine.
What is the SMILES notation for 2,5-dihydro-1,2-benzothiazepine?
The canonical SMILES for 2,5-dihydro-1,2-benzothiazepine is C1=CNSc2ccccc2C1.
What is the InChIKey of 2,5-dihydro-1,2-benzothiazepine?
The InChIKey is JHDXBQQGTRRSIX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9NS/c1-2-6-9-8(4-1)5-3-7-10-11-9/h1-4,6-7,10H,5H2.
What are the key properties of 2,5-dihydro-1,2-benzothiazepine?
2,5-dihydro-1,2-benzothiazepine has a molecular weight of 163.25 g/mol, XLogP of 2.35, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-dihydro-1,2-benzothiazepine is sourced from PubChem (CID 22025886), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).