About (3,5-dimethylphenyl) carbonochloridate
(3,5-dimethylphenyl) carbonochloridate (PubChem CID 22026189) has the molecular formula C9H9ClO2
and a molecular weight of 184.62 g/mol. Its IUPAC name is (3,5-dimethylphenyl) carbonochloridate.
Molecular Properties
| Compound Name | (3,5-dimethylphenyl) carbonochloridate |
| PubChem CID | 22026189 |
| Molecular Formula | C9H9ClO2 |
| Molecular Weight | 184.62 g/mol |
| Exact Mass | 184.03 |
| IUPAC Name | (3,5-dimethylphenyl) carbonochloridate |
| SMILES | Cc1cc(C)cc(OC(=O)Cl)c1 |
| InChI | InChI=1S/C9H9ClO2/c1-6-3-7(2)5-8(4-6)12-9(10)11/h3-5H,1-2H3 |
| InChIKey | KLLAFPIQULNDBN-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.62 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|
Analyze (3,5-dimethylphenyl) carbonochloridate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3,5-dimethylphenyl) carbonochloridate?
The IUPAC name of (3,5-dimethylphenyl) carbonochloridate (CID 22026189) is (3,5-dimethylphenyl) carbonochloridate.
What is the SMILES notation for (3,5-dimethylphenyl) carbonochloridate?
The canonical SMILES for (3,5-dimethylphenyl) carbonochloridate is Cc1cc(C)cc(OC(=O)Cl)c1.
What is the InChIKey of (3,5-dimethylphenyl) carbonochloridate?
The InChIKey is KLLAFPIQULNDBN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9ClO2/c1-6-3-7(2)5-8(4-6)12-9(10)11/h3-5H,1-2H3.
What are the key properties of (3,5-dimethylphenyl) carbonochloridate?
(3,5-dimethylphenyl) carbonochloridate has a molecular weight of 184.62 g/mol, XLogP of 3.04, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3,5-dimethylphenyl) carbonochloridate is sourced from PubChem (CID 22026189), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).