About 3,5-dichloro-2,4,6-trifluorobenzaldehyde
3,5-dichloro-2,4,6-trifluorobenzaldehyde (PubChem CID 22026357) has the molecular formula C7HCl2F3O
and a molecular weight of 228.98 g/mol. Its IUPAC name is 3,5-dichloro-2,4,6-trifluorobenzaldehyde.
Molecular Properties
| Compound Name | 3,5-dichloro-2,4,6-trifluorobenzaldehyde |
| PubChem CID | 22026357 |
| Molecular Formula | C7HCl2F3O |
| Molecular Weight | 228.98 g/mol |
| Exact Mass | 227.94 |
| IUPAC Name | 3,5-dichloro-2,4,6-trifluorobenzaldehyde |
| SMILES | O=Cc1c(F)c(Cl)c(F)c(Cl)c1F |
| InChI | InChI=1S/C7HCl2F3O/c8-3-5(10)2(1-13)6(11)4(9)7(3)12/h1H |
| InChIKey | BCKHICABXCTJJL-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.98 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|
Analyze 3,5-dichloro-2,4,6-trifluorobenzaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-dichloro-2,4,6-trifluorobenzaldehyde?
The IUPAC name of 3,5-dichloro-2,4,6-trifluorobenzaldehyde (CID 22026357) is 3,5-dichloro-2,4,6-trifluorobenzaldehyde.
What is the SMILES notation for 3,5-dichloro-2,4,6-trifluorobenzaldehyde?
The canonical SMILES for 3,5-dichloro-2,4,6-trifluorobenzaldehyde is O=Cc1c(F)c(Cl)c(F)c(Cl)c1F.
What is the InChIKey of 3,5-dichloro-2,4,6-trifluorobenzaldehyde?
The InChIKey is BCKHICABXCTJJL-UHFFFAOYSA-N. The full InChI is InChI=1S/C7HCl2F3O/c8-3-5(10)2(1-13)6(11)4(9)7(3)12/h1H.
What are the key properties of 3,5-dichloro-2,4,6-trifluorobenzaldehyde?
3,5-dichloro-2,4,6-trifluorobenzaldehyde has a molecular weight of 228.98 g/mol, XLogP of 3.22, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-dichloro-2,4,6-trifluorobenzaldehyde is sourced from PubChem (CID 22026357), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).