C8H15N5 — CID 22027372
6-ethyl-2-N-propan-2-yl-1,3,5-triazine-2,4-diamine (PubChem CID 22027372) has the molecular formula C8H15N5 and a molecular weight of 181.24 g/mol. Its IUPAC name is 6-ethyl-2-N-propan-2-yl-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-ethyl-2-N-propan-2-yl-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 22027372 |
| Molecular Formula | C8H15N5 |
| Molecular Weight | 181.24 g/mol |
| Exact Mass | 181.13 |
| IUPAC Name | 6-ethyl-2-N-propan-2-yl-1,3,5-triazine-2,4-diamine |
| SMILES | CCc1nc(N)nc(NC(C)C)n1 |
| InChI | InChI=1S/C8H15N5/c1-4-6-11-7(9)13-8(12-6)10-5(2)3/h5H,4H2,1-3H3,(H3,9,10,11,12,13) |
| InChIKey | SCJBQWWQLKJQRI-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 76.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.24 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |