About pentane-1,2,3-triamine
pentane-1,2,3-triamine (PubChem CID 22027503) has the molecular formula C5H15N3
and a molecular weight of 117.20 g/mol. Its IUPAC name is pentane-1,2,3-triamine.
Molecular Properties
| Compound Name | pentane-1,2,3-triamine |
| PubChem CID | 22027503 |
| Molecular Formula | C5H15N3 |
| Molecular Weight | 117.20 g/mol |
| Exact Mass | 117.13 |
| IUPAC Name | pentane-1,2,3-triamine |
| SMILES | CCC(N)C(N)CN |
| InChI | InChI=1S/C5H15N3/c1-2-4(7)5(8)3-6/h4-5H,2-3,6-8H2,1H3 |
| InChIKey | WKQXKMPAJBDQGB-UHFFFAOYSA-N |
| XLogP | -0.99 |
| TPSA | 78.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 117.20 |
| LogP ≤ 5 | -0.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze pentane-1,2,3-triamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pentane-1,2,3-triamine?
The IUPAC name of pentane-1,2,3-triamine (CID 22027503) is pentane-1,2,3-triamine.
What is the SMILES notation for pentane-1,2,3-triamine?
The canonical SMILES for pentane-1,2,3-triamine is CCC(N)C(N)CN.
What is the InChIKey of pentane-1,2,3-triamine?
The InChIKey is WKQXKMPAJBDQGB-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H15N3/c1-2-4(7)5(8)3-6/h4-5H,2-3,6-8H2,1H3.
What are the key properties of pentane-1,2,3-triamine?
pentane-1,2,3-triamine has a molecular weight of 117.20 g/mol, XLogP of -0.99, 3 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for pentane-1,2,3-triamine is sourced from PubChem (CID 22027503), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).