C25H19NO8S — CID 22027553
3-[2-[(3',6'-dihydroxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-5-yl)amino]-2-oxoethyl]sulfanylpropanoic acid (PubChem CID 22027553) has the molecular formula C25H19NO8S and a molecular weight of 493.49 g/mol. Its IUPAC name is 3-[2-[(3',6'-dihydroxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-5-yl)amino]-2-oxoethyl]sulfanylpropanoic acid.
| Compound Name | 3-[2-[(3',6'-dihydroxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-5-yl)amino]-2-oxoethyl]sulfanylpropanoic acid |
|---|---|
| PubChem CID | 22027553 |
| Molecular Formula | C25H19NO8S |
| Molecular Weight | 493.49 g/mol |
| Exact Mass | 493.08 |
| IUPAC Name | 3-[2-[(3',6'-dihydroxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-5-yl)amino]-2-oxoethyl]sulfanylpropanoic acid |
| SMILES | O=C(O)CCSCC(=O)Nc1ccc2c(c1)C(=O)OC21c2ccc(O)cc2Oc2cc(O)ccc21 |
| InChI | InChI=1S/C25H19NO8S/c27-14-2-5-18-20(10-14)33-21-11-15(28)3-6-19(21)25(18)17-4-1-13(9-16(17)24(32)34-25)26-22(29)12-35-8-7-23(30)31/h1-6,9-11,27-28H,7-8,12H2,(H,26,29)(H,30,31) |
| InChIKey | AJCUCAVQNSVXPC-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 142.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.49 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|