C13H13ClF3N3O3S2 — CID 22028040
3-chloro-2-methyl-N-[3-[2-(2,2,2-trifluoroethoxy)ethyl]-1,2,4-thiadiazol-5-yl]benzenesulfonamide (PubChem CID 22028040) has the molecular formula C13H13ClF3N3O3S2 and a molecular weight of 415.85 g/mol. Its IUPAC name is 3-chloro-2-methyl-N-[3-[2-(2,2,2-trifluoroethoxy)ethyl]-1,2,4-thiadiazol-5-yl]benzenesulfonamide.
| Compound Name | 3-chloro-2-methyl-N-[3-[2-(2,2,2-trifluoroethoxy)ethyl]-1,2,4-thiadiazol-5-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 22028040 |
| Molecular Formula | C13H13ClF3N3O3S2 |
| Molecular Weight | 415.85 g/mol |
| Exact Mass | 415.00 |
| IUPAC Name | 3-chloro-2-methyl-N-[3-[2-(2,2,2-trifluoroethoxy)ethyl]-1,2,4-thiadiazol-5-yl]benzenesulfonamide |
| SMILES | Cc1c(Cl)cccc1S(=O)(=O)Nc1nc(CCOCC(F)(F)F)ns1 |
| InChI | InChI=1S/C13H13ClF3N3O3S2/c1-8-9(14)3-2-4-10(8)25(21,22)20-12-18-11(19-24-12)5-6-23-7-13(15,16)17/h2-4H,5-7H2,1H3,(H,18,19,20) |
| InChIKey | KOACNMFIFUALMD-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 81.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.85 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|