C13H10N2O2S — CID 22028181
3-(benzenesulfonyl)-1H-pyrrolo[2,3-b]pyridine (PubChem CID 22028181) has the molecular formula C13H10N2O2S and a molecular weight of 258.30 g/mol. Its IUPAC name is 3-(benzenesulfonyl)-1H-pyrrolo[2,3-b]pyridine.
| Compound Name | 3-(benzenesulfonyl)-1H-pyrrolo[2,3-b]pyridine |
|---|---|
| PubChem CID | 22028181 |
| Molecular Formula | C13H10N2O2S |
| Molecular Weight | 258.30 g/mol |
| Exact Mass | 258.05 |
| IUPAC Name | 3-(benzenesulfonyl)-1H-pyrrolo[2,3-b]pyridine |
| SMILES | O=S(=O)(c1ccccc1)c1c[nH]c2ncccc12 |
| InChI | InChI=1S/C13H10N2O2S/c16-18(17,10-5-2-1-3-6-10)12-9-15-13-11(12)7-4-8-14-13/h1-9H,(H,14,15) |
| InChIKey | XIVJYIWQYBHEBJ-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 62.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.30 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |