C20H38O5 — CID 22028202
3-(4,4-diethoxy-2-methylpent-1-en-3-yl)oxy-4,4-diethoxy-2-methylpent-1-ene (PubChem CID 22028202) has the molecular formula C20H38O5 and a molecular weight of 358.52 g/mol. Its IUPAC name is 3-(4,4-diethoxy-2-methylpent-1-en-3-yl)oxy-4,4-diethoxy-2-methylpent-1-ene.
| Compound Name | 3-(4,4-diethoxy-2-methylpent-1-en-3-yl)oxy-4,4-diethoxy-2-methylpent-1-ene |
|---|---|
| PubChem CID | 22028202 |
| Molecular Formula | C20H38O5 |
| Molecular Weight | 358.52 g/mol |
| Exact Mass | 358.27 |
| IUPAC Name | 3-(4,4-diethoxy-2-methylpent-1-en-3-yl)oxy-4,4-diethoxy-2-methylpent-1-ene |
| SMILES | C=C(C)C(OC(C(=C)C)C(C)(OCC)OCC)C(C)(OCC)OCC |
| InChI | InChI=1S/C20H38O5/c1-11-21-19(9,22-12-2)17(15(5)6)25-18(16(7)8)20(10,23-13-3)24-14-4/h17-18H,5,7,11-14H2,1-4,6,8-10H3 |
| InChIKey | VFSADNLQHKPIPC-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.52 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|