C16H17N3O3S — CID 22028905
2-[5-(1,3-thiazolidine-3-carbonyl)pyrrolidin-3-yl]isoindole-1,3-dione (PubChem CID 22028905) has the molecular formula C16H17N3O3S and a molecular weight of 331.40 g/mol. Its IUPAC name is 2-[5-(1,3-thiazolidine-3-carbonyl)pyrrolidin-3-yl]isoindole-1,3-dione.
| Compound Name | 2-[5-(1,3-thiazolidine-3-carbonyl)pyrrolidin-3-yl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 22028905 |
| Molecular Formula | C16H17N3O3S |
| Molecular Weight | 331.40 g/mol |
| Exact Mass | 331.10 |
| IUPAC Name | 2-[5-(1,3-thiazolidine-3-carbonyl)pyrrolidin-3-yl]isoindole-1,3-dione |
| SMILES | O=C(C1CC(N2C(=O)c3ccccc3C2=O)CN1)N1CCSC1 |
| InChI | InChI=1S/C16H17N3O3S/c20-14-11-3-1-2-4-12(11)15(21)19(14)10-7-13(17-8-10)16(22)18-5-6-23-9-18/h1-4,10,13,17H,5-9H2 |
| InChIKey | NMKZSPCQMOZDAS-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.40 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|