C19H25F3N6O4 — CID 22029381
7-but-2-ynyl-3-methyl-8-piperazin-1-yl-1-propan-2-ylpurine-2,6-dione;2,2,2-trifluoroacetic acid (PubChem CID 22029381) has the molecular formula C19H25F3N6O4 and a molecular weight of 458.44 g/mol. Its IUPAC name is 7-but-2-ynyl-3-methyl-8-piperazin-1-yl-1-propan-2-ylpurine-2,6-dione;2,2,2-trifluoroacetic acid.
| Compound Name | 7-but-2-ynyl-3-methyl-8-piperazin-1-yl-1-propan-2-ylpurine-2,6-dione;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 22029381 |
| Molecular Formula | C19H25F3N6O4 |
| Molecular Weight | 458.44 g/mol |
| Exact Mass | 458.19 |
| IUPAC Name | 7-but-2-ynyl-3-methyl-8-piperazin-1-yl-1-propan-2-ylpurine-2,6-dione;2,2,2-trifluoroacetic acid |
| SMILES | CC#CCn1c(N2CCNCC2)nc2c1c(=O)n(C(C)C)c(=O)n2C.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C17H24N6O2.C2HF3O2/c1-5-6-9-22-13-14(19-16(22)21-10-7-18-8-11-21)20(4)17(25)23(12(2)3)15(13)24;3-2(4,5)1(6)7/h12,18H,7-11H2,1-4H3;(H,6,7) |
| InChIKey | LETSHPJTPLMPGC-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 114.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.44 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|