C20H27F3N6O5 — CID 22029436
7-but-2-ynyl-3-(2-ethoxyethyl)-1-methyl-8-piperazin-1-ylpurine-2,6-dione;2,2,2-trifluoroacetic acid (PubChem CID 22029436) has the molecular formula C20H27F3N6O5 and a molecular weight of 488.47 g/mol. Its IUPAC name is 7-but-2-ynyl-3-(2-ethoxyethyl)-1-methyl-8-piperazin-1-ylpurine-2,6-dione;2,2,2-trifluoroacetic acid.
| Compound Name | 7-but-2-ynyl-3-(2-ethoxyethyl)-1-methyl-8-piperazin-1-ylpurine-2,6-dione;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 22029436 |
| Molecular Formula | C20H27F3N6O5 |
| Molecular Weight | 488.47 g/mol |
| Exact Mass | 488.20 |
| IUPAC Name | 7-but-2-ynyl-3-(2-ethoxyethyl)-1-methyl-8-piperazin-1-ylpurine-2,6-dione;2,2,2-trifluoroacetic acid |
| SMILES | CC#CCn1c(N2CCNCC2)nc2c1c(=O)n(C)c(=O)n2CCOCC.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C18H26N6O3.C2HF3O2/c1-4-6-9-23-14-15(20-17(23)22-10-7-19-8-11-22)24(12-13-27-5-2)18(26)21(3)16(14)25;3-2(4,5)1(6)7/h19H,5,7-13H2,1-3H3;(H,6,7) |
| InChIKey | XNPYWDQTDYOMFZ-UHFFFAOYSA-N |
| XLogP | -0.00 |
| TPSA | 123.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.47 |
| LogP ≤ 5 | -0.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|