C26H31F3N6O6 — CID 22029447
2-[3-methyl-7-(3-methylbut-2-enyl)-2,6-dioxo-8-piperazin-1-ylpurin-1-yl]ethyl benzoate;2,2,2-trifluoroacetic acid (PubChem CID 22029447) has the molecular formula C26H31F3N6O6 and a molecular weight of 580.56 g/mol. Its IUPAC name is 2-[3-methyl-7-(3-methylbut-2-enyl)-2,6-dioxo-8-piperazin-1-ylpurin-1-yl]ethyl benzoate;2,2,2-trifluoroacetic acid.
| Compound Name | 2-[3-methyl-7-(3-methylbut-2-enyl)-2,6-dioxo-8-piperazin-1-ylpurin-1-yl]ethyl benzoate;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 22029447 |
| Molecular Formula | C26H31F3N6O6 |
| Molecular Weight | 580.56 g/mol |
| Exact Mass | 580.23 |
| IUPAC Name | 2-[3-methyl-7-(3-methylbut-2-enyl)-2,6-dioxo-8-piperazin-1-ylpurin-1-yl]ethyl benzoate;2,2,2-trifluoroacetic acid |
| SMILES | CC(C)=CCn1c(N2CCNCC2)nc2c1c(=O)n(CCOC(=O)c1ccccc1)c(=O)n2C.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C24H30N6O4.C2HF3O2/c1-17(2)9-12-29-19-20(26-23(29)28-13-10-25-11-14-28)27(3)24(33)30(21(19)31)15-16-34-22(32)18-7-5-4-6-8-18;3-2(4,5)1(6)7/h4-9,25H,10-16H2,1-3H3;(H,6,7) |
| InChIKey | CJXADBMFHIQSKQ-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 140.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.56 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|