About 2-[7-(2-chlorophenyl)-2,6-dioxo-8-piperazin-1-ylpurin-3-yl]acetonitrile
2-[7-(2-chlorophenyl)-2,6-dioxo-8-piperazin-1-ylpurin-3-yl]acetonitrile (PubChem CID 22029534) has the molecular formula C17H16ClN7O2
and a molecular weight of 385.82 g/mol. Its IUPAC name is 2-[7-(2-chlorophenyl)-2,6-dioxo-8-piperazin-1-ylpurin-3-yl]acetonitrile.
Molecular Properties
| Compound Name | 2-[7-(2-chlorophenyl)-2,6-dioxo-8-piperazin-1-ylpurin-3-yl]acetonitrile |
| PubChem CID | 22029534 |
| Molecular Formula | C17H16ClN7O2 |
| Molecular Weight | 385.82 g/mol |
| Exact Mass | 385.11 |
| IUPAC Name | 2-[7-(2-chlorophenyl)-2,6-dioxo-8-piperazin-1-ylpurin-3-yl]acetonitrile |
| SMILES | N#CCn1c(=O)[nH]c(=O)c2c1nc(N1CCNCC1)n2-c1ccccc1Cl |
| InChI | InChI=1S/C17H16ClN7O2/c18-11-3-1-2-4-12(11)25-13-14(21-16(25)23-9-6-20-7-10-23)24(8-5-19)17(27)22-15(13)26/h1-4,20H,6-10H2,(H,22,26,27) |
| InChIKey | LJQDBEKDPDVHLZ-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 111.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 385.82 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze 2-[7-(2-chlorophenyl)-2,6-dioxo-8-piperazin-1-ylpurin-3-yl]acetonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[7-(2-chlorophenyl)-2,6-dioxo-8-piperazin-1-ylpurin-3-yl]acetonitrile?
The IUPAC name of 2-[7-(2-chlorophenyl)-2,6-dioxo-8-piperazin-1-ylpurin-3-yl]acetonitrile (CID 22029534) is 2-[7-(2-chlorophenyl)-2,6-dioxo-8-piperazin-1-ylpurin-3-yl]acetonitrile.
What is the SMILES notation for 2-[7-(2-chlorophenyl)-2,6-dioxo-8-piperazin-1-ylpurin-3-yl]acetonitrile?
The canonical SMILES for 2-[7-(2-chlorophenyl)-2,6-dioxo-8-piperazin-1-ylpurin-3-yl]acetonitrile is N#CCn1c(=O)[nH]c(=O)c2c1nc(N1CCNCC1)n2-c1ccccc1Cl.
What is the InChIKey of 2-[7-(2-chlorophenyl)-2,6-dioxo-8-piperazin-1-ylpurin-3-yl]acetonitrile?
The InChIKey is LJQDBEKDPDVHLZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H16ClN7O2/c18-11-3-1-2-4-12(11)25-13-14(21-16(25)23-9-6-20-7-10-23)24(8-5-19)17(27)22-15(13)26/h1-4,20H,6-10H2,(H,22,26,27).
What are the key properties of 2-[7-(2-chlorophenyl)-2,6-dioxo-8-piperazin-1-ylpurin-3-yl]acetonitrile?
2-[7-(2-chlorophenyl)-2,6-dioxo-8-piperazin-1-ylpurin-3-yl]acetonitrile has a molecular weight of 385.82 g/mol, XLogP of 0.46, 3 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[7-(2-chlorophenyl)-2,6-dioxo-8-piperazin-1-ylpurin-3-yl]acetonitrile is sourced from PubChem (CID 22029534), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).