C20H25F3N6O6 — CID 22029630
2-(7-but-2-ynyl-3-methyl-2,6-dioxo-8-piperazin-1-ylpurin-1-yl)ethyl acetate;2,2,2-trifluoroacetic acid (PubChem CID 22029630) has the molecular formula C20H25F3N6O6 and a molecular weight of 502.45 g/mol. Its IUPAC name is 2-(7-but-2-ynyl-3-methyl-2,6-dioxo-8-piperazin-1-ylpurin-1-yl)ethyl acetate;2,2,2-trifluoroacetic acid.
| Compound Name | 2-(7-but-2-ynyl-3-methyl-2,6-dioxo-8-piperazin-1-ylpurin-1-yl)ethyl acetate;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 22029630 |
| Molecular Formula | C20H25F3N6O6 |
| Molecular Weight | 502.45 g/mol |
| Exact Mass | 502.18 |
| IUPAC Name | 2-(7-but-2-ynyl-3-methyl-2,6-dioxo-8-piperazin-1-ylpurin-1-yl)ethyl acetate;2,2,2-trifluoroacetic acid |
| SMILES | CC#CCn1c(N2CCNCC2)nc2c1c(=O)n(CCOC(C)=O)c(=O)n2C.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C18H24N6O4.C2HF3O2/c1-4-5-8-23-14-15(20-17(23)22-9-6-19-7-10-22)21(3)18(27)24(16(14)26)11-12-28-13(2)25;3-2(4,5)1(6)7/h19H,6-12H2,1-3H3;(H,6,7) |
| InChIKey | UFUKCEOBCQEPBT-UHFFFAOYSA-N |
| XLogP | -0.47 |
| TPSA | 140.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.45 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|