C19H24F4N6O4 — CID 22029662
7-but-2-ynyl-3-(3-fluoropropyl)-1-methyl-8-piperazin-1-ylpurine-2,6-dione;2,2,2-trifluoroacetic acid (PubChem CID 22029662) has the molecular formula C19H24F4N6O4 and a molecular weight of 476.43 g/mol. Its IUPAC name is 7-but-2-ynyl-3-(3-fluoropropyl)-1-methyl-8-piperazin-1-ylpurine-2,6-dione;2,2,2-trifluoroacetic acid.
| Compound Name | 7-but-2-ynyl-3-(3-fluoropropyl)-1-methyl-8-piperazin-1-ylpurine-2,6-dione;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 22029662 |
| Molecular Formula | C19H24F4N6O4 |
| Molecular Weight | 476.43 g/mol |
| Exact Mass | 476.18 |
| IUPAC Name | 7-but-2-ynyl-3-(3-fluoropropyl)-1-methyl-8-piperazin-1-ylpurine-2,6-dione;2,2,2-trifluoroacetic acid |
| SMILES | CC#CCn1c(N2CCNCC2)nc2c1c(=O)n(C)c(=O)n2CCCF.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C17H23FN6O2.C2HF3O2/c1-3-4-9-23-13-14(20-16(23)22-11-7-19-8-12-22)24(10-5-6-18)17(26)21(2)15(13)25;3-2(4,5)1(6)7/h19H,5-12H2,1-2H3;(H,6,7) |
| InChIKey | OJJTYYSFMCKMOZ-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 114.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.43 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|